CAS 891017-36-0 appears in our catalog under these names: 4-Methoxy-3-(1h-1,2,3,4-tetrazol-1-yl)aniline, 95%, 4-Methoxy-3-(1H-1,2,3,4-tetrazol-1-yl)aniline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 2,5g.
4-methoxy-3-(tetrazol-1-yl)aniline (CAS 891017-36-0) is a chemical compound with the molecular formula C8H9N5O and a molecular weight of 191.19 g/mol. IUPAC name: 4-methoxy-3-(tetrazol-1-yl)aniline. InChIKey: RIPPAMITZFWDCY-UHFFFAOYSA-N.
| Molecular formula | C8H9N5O |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 4-methoxy-3-(tetrazol-1-yl)aniline |
| InChIKey | RIPPAMITZFWDCY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N)N2C=NN=N2 |
Computed by PubChem (NCBI)