CAS 2270905-51-4 is the registry number for 1-(2-Amino-7-methyl[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(2-amino-7-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone (CAS 2270905-51-4) is a chemical compound with the molecular formula C8H9N5O and a molecular weight of 191.19 g/mol. IUPAC name: 1-(2-amino-7-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone. InChIKey: VDIUOAKYMSZONS-UHFFFAOYSA-N.
| Molecular formula | C8H9N5O |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 1-(2-amino-7-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone |
| InChIKey | VDIUOAKYMSZONS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NC2=NC(=NN12)N)C(=O)C |
Computed by PubChem (NCBI)