CAS 2089664-78-6 is the registry number for 2-Amino-2-(pyrrolo[2,1-f][1,2,4]triazin-2-yl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-2-pyrrolo[2,1-f][1,2,4]triazin-2-ylacetamide (CAS 2089664-78-6) is a chemical compound with the molecular formula C8H9N5O and a molecular weight of 191.19 g/mol. IUPAC name: 2-amino-2-pyrrolo[2,1-f][1,2,4]triazin-2-ylacetamide. InChIKey: AKTOYBPBZIQDER-UHFFFAOYSA-N.
| Molecular formula | C8H9N5O |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 2-amino-2-pyrrolo[2,1-f][1,2,4]triazin-2-ylacetamide |
| InChIKey | AKTOYBPBZIQDER-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C1)C=NC(=N2)C(C(=O)N)N |
Computed by PubChem (NCBI)