CAS 25716-33-0 appears in our catalog under these names: 2-amino-7-ethylpteridin-4(3H)-one, 2-Amino-7-ethyl-4(3H)-pteridinone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
2-amino-7-ethyl-3H-pteridin-4-one (CAS 25716-33-0) is a chemical compound with the molecular formula C8H9N5O and a molecular weight of 191.19 g/mol. IUPAC name: 2-amino-7-ethyl-3H-pteridin-4-one. InChIKey: IXEADLVCSJIVBH-UHFFFAOYSA-N.
| Molecular formula | C8H9N5O |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 2-amino-7-ethyl-3H-pteridin-4-one |
| InChIKey | IXEADLVCSJIVBH-UHFFFAOYSA-N |
| SMILES | CCC1=CN=C2C(=O)NC(=NC2=N1)N |
Computed by PubChem (NCBI)