CAS 98488-77-8 is the registry number for N-(2-Furylmethyl)-1,3,5-triazine-2,4-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-N-(furan-2-ylmethyl)-1,3,5-triazine-2,4-diamine (CAS 98488-77-8) is a chemical compound with the molecular formula C8H9N5O and a molecular weight of 191.19 g/mol. IUPAC name: 2-N-(furan-2-ylmethyl)-1,3,5-triazine-2,4-diamine. InChIKey: WWAKIQZEDXQUQS-UHFFFAOYSA-N.
| Molecular formula | C8H9N5O |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 2-N-(furan-2-ylmethyl)-1,3,5-triazine-2,4-diamine |
| InChIKey | WWAKIQZEDXQUQS-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)CNC2=NC=NC(=N2)N |
Computed by PubChem (NCBI)