CAS 569648-15-3 is the registry number for 5-Methoxy-2-(1H-tetrazol-1-yl)aniline. Offered by: Biosynth. Available pack sizes: 2,5g.
5-methoxy-2-(tetrazol-1-yl)aniline (CAS 569648-15-3) is a chemical compound with the molecular formula C8H9N5O and a molecular weight of 191.19 g/mol. IUPAC name: 5-methoxy-2-(tetrazol-1-yl)aniline. InChIKey: XIRTVSDJTGYPDJ-UHFFFAOYSA-N.
| Molecular formula | C8H9N5O |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 5-methoxy-2-(tetrazol-1-yl)aniline |
| InChIKey | XIRTVSDJTGYPDJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)N2C=NN=N2)N |
Computed by PubChem (NCBI)