CAS 21869-84-1 appears in our catalog under these names: 7-Allyl-2-amino-3h-purin-6(7h)-one, 95%, 7–allyl–2–amino–3H–purin–6(7H)–one. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2-amino-7-prop-2-enyl-1H-purin-6-one (CAS 21869-84-1) is a chemical compound with the molecular formula C8H9N5O and a molecular weight of 191.19 g/mol. IUPAC name: 2-amino-7-prop-2-enyl-1H-purin-6-one. InChIKey: JLXNWMULWUSNNZ-UHFFFAOYSA-N.
| Molecular formula | C8H9N5O |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 2-amino-7-prop-2-enyl-1H-purin-6-one |
| InChIKey | JLXNWMULWUSNNZ-UHFFFAOYSA-N |
| SMILES | C=CCN1C=NC2=C1C(=O)NC(=N2)N |
Computed by PubChem (NCBI)