CAS 1909310-10-6 appears in our catalog under these names: 2-Phenyl-4H,5H,6H,7H-furo(3,2-c)pyridine hydrochloride, 95%, 2-Phenyl-4H,5H,6H,7H-furo(3,2-c)pyridine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-phenyl-4,5,6,7-tetrahydrofuro[3,2-c]pyridine;hydrochloride (CAS 1909310-10-6) is a chemical compound with the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. IUPAC name: 2-phenyl-4,5,6,7-tetrahydrofuro[3,2-c]pyridine;hydrochloride. InChIKey: VGWUWLWYAMCSDW-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | 2-phenyl-4,5,6,7-tetrahydrofuro[3,2-c]pyridine;hydrochloride |
| InChIKey | VGWUWLWYAMCSDW-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1OC(=C2)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)