CAS 1909313-31-0 is the registry number for 4-Oxo-4H-pyrano(2,3-c)pyridine-2-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-oxopyrano[2,3-c]pyridine-2-carboxylic acid;hydrochloride (CAS 1909313-31-0) is a chemical compound with the molecular formula C9H6ClNO4 and a molecular weight of 227.60 g/mol. IUPAC name: 4-oxopyrano[2,3-c]pyridine-2-carboxylic acid;hydrochloride. InChIKey: RMONHQFZTZXYBQ-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO4 |
|---|---|
| Molecular weight | 227.60 g/mol |
| IUPAC name | 4-oxopyrano[2,3-c]pyridine-2-carboxylic acid;hydrochloride |
| InChIKey | RMONHQFZTZXYBQ-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C1C(=O)C=C(O2)C(=O)O.Cl |
Computed by PubChem (NCBI)