Products 20357-28-2
CAS 20357-28-2 is the registry number for 5-Chloro-2-nitrocinnamic acid. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg, 2000mg, 5000mg.
(E)-3-(5-chloro-2-nitrophenyl)prop-2-enoic acid (CAS 20357-28-2) is a chemical compound with the molecular formula C9H6ClNO4 and a molecular weight of 227.60 g/mol. IUPAC name: (E)-3-(5-chloro-2-nitrophenyl)prop-2-enoic acid. InChIKey: PXHIUBAKYZFXKE-DAFODLJHSA-N.
| Molecular formula | C9H6ClNO4 |
|---|---|
| Molecular weight | 227.60 g/mol |
| IUPAC name | (E)-3-(5-chloro-2-nitrophenyl)prop-2-enoic acid |
| InChIKey | PXHIUBAKYZFXKE-DAFODLJHSA-N |
| SMILES | C1=CC(=C(C=C1Cl)/C=C/C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
5-Chloro-2-nitrocinnamic acid, 3-(5-chloro-2-nitrophenyl)prop-2-enoic acid, (E)-3-(5-chloro-2-nitrophenyl)prop-2-enoic acid, 3-(5-Chloro-2-nitrophenyl)acrylic acid, 2-Propenoic acid, 3-(5-chloro-2-nitrophenyl)-, (E)-3-(5-chloro-2-nitrophenyl)acrylic acid, (E)-3-(5-chloro-2-nitro-phenyl)prop-2-enoic acid, (2E)-3-(5-Chloro-2-nitrophenyl)-2-propenoic acid #