CAS 205744-82-7 is the registry number for 2-(4-Chloro-2-nitrophenyl)malondialdehyde, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.
2-(4-chloro-2-nitrophenyl)propanedial (CAS 205744-82-7) is a chemical compound with the molecular formula C9H6ClNO4 and a molecular weight of 227.60 g/mol. IUPAC name: 2-(4-chloro-2-nitrophenyl)propanedial. InChIKey: NYLPVNGQGLWFEA-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO4 |
|---|---|
| Molecular weight | 227.60 g/mol |
| IUPAC name | 2-(4-chloro-2-nitrophenyl)propanedial |
| InChIKey | NYLPVNGQGLWFEA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)[N+](=O)[O-])C(C=O)C=O |
Computed by PubChem (NCBI)