CAS 36015-19-7 appears in our catalog under these names: 2-Chloro-5-nitrocinnamic acid, 98%, 2–Chloro–5–nitrocinnamic Acid, 2-Chloro-5-nitrocinnamic Acid, >97.0%(T)(GC), 2-Chloro-5-nitrocinnamic acid, 3-(2-Chloro-5-nitrophenyl)acrylic acid 98% (E). Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: 1g, 25g, 5g, 50g, 100g, 250g.
(E)-3-(2-chloro-5-nitrophenyl)prop-2-enoic acid (CAS 36015-19-7) is a chemical compound with the molecular formula C9H6ClNO4 and a molecular weight of 227.60 g/mol. IUPAC name: (E)-3-(2-chloro-5-nitrophenyl)prop-2-enoic acid. InChIKey: IHTLKLSRRSWIGD-DAFODLJHSA-N.
| Molecular formula | C9H6ClNO4 |
|---|---|
| Molecular weight | 227.60 g/mol |
| IUPAC name | (E)-3-(2-chloro-5-nitrophenyl)prop-2-enoic acid |
| InChIKey | IHTLKLSRRSWIGD-DAFODLJHSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])/C=C/C(=O)O)Cl |
Computed by PubChem (NCBI)