CAS 19739-40-3 appears in our catalog under these names: (6-Chloro-2-oxo-1,3-benzoxazol-3(2h)-yl)acetic acid, 95%, 2-(6-Chloro-2-oxobenzo(d)oxazol-3(2H)-yl)acetic acid, 97%, (6-Chloro-2-oxo-1,3-benzoxazol-3(2H)-yl)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 0,25g, 0,1g, 0,5g, 2g.
2-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)acetic acid (CAS 19739-40-3) is a chemical compound with the molecular formula C9H6ClNO4 and a molecular weight of 227.60 g/mol. IUPAC name: 2-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)acetic acid. InChIKey: GZVFFZYANBZGHW-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO4 |
|---|---|
| Molecular weight | 227.60 g/mol |
| IUPAC name | 2-(6-chloro-2-oxo-1,3-benzoxazol-3-yl)acetic acid |
| InChIKey | GZVFFZYANBZGHW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)OC(=O)N2CC(=O)O |
Computed by PubChem (NCBI)