Products 199679-38-4

CAS 199679-38-4 is the registry number for (E)-3-(4-Chloro-3-nitrophenyl)acrylic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g, 100g.

Structural formula: {0} (CAS {1})

(E)-3-(4-chloro-3-nitrophenyl)prop-2-enoic acid (CAS 199679-38-4) is a chemical compound with the molecular formula C9H6ClNO4 and a molecular weight of 227.60 g/mol. IUPAC name: (E)-3-(4-chloro-3-nitrophenyl)prop-2-enoic acid. InChIKey: QBDALTIMHOITIU-DUXPYHPUSA-N.

Identity
Molecular formulaC9H6ClNO4
Molecular weight227.60 g/mol
IUPAC name(E)-3-(4-chloro-3-nitrophenyl)prop-2-enoic acid
InChIKeyQBDALTIMHOITIU-DUXPYHPUSA-N
SMILESC1=CC(=C(C=C1/C=C/C(=O)O)[N+](=O)[O-])Cl

Computed by PubChem (NCBI)