CAS 29176-90-7 is the registry number for (5-Chloro-2-oxo-benzooxazol-3-yl)-acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)acetic acid (CAS 29176-90-7) is a chemical compound with the molecular formula C9H6ClNO4 and a molecular weight of 227.60 g/mol. IUPAC name: 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)acetic acid. InChIKey: HAUYIEZNIDPDKP-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO4 |
|---|---|
| Molecular weight | 227.60 g/mol |
| IUPAC name | 2-(5-chloro-2-oxo-1,3-benzoxazol-3-yl)acetic acid |
| InChIKey | HAUYIEZNIDPDKP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N(C(=O)O2)CC(=O)O |
Computed by PubChem (NCBI)