Products 2092454-17-4
CAS 2092454-17-4 is the registry number for Methyl 7-chloro-3-hydroxyfuro[2,3-c]pyridine-2-carboxylate, 95%. Offered by: Ambeed. Available pack sizes: 250mg.
Methyl 7-chloro-3-hydroxyfuro[2,3-c]pyridine-2-carboxylate (CAS 2092454-17-4) is a chemical compound with the molecular formula C9H6ClNO4 and a molecular weight of 227.60 g/mol. IUPAC name: methyl 7-chloro-3-hydroxyfuro[2,3-c]pyridine-2-carboxylate. InChIKey: JJGVYFCVNRXENG-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO4 |
|---|---|
| Molecular weight | 227.60 g/mol |
| IUPAC name | methyl 7-chloro-3-hydroxyfuro[2,3-c]pyridine-2-carboxylate |
| InChIKey | JJGVYFCVNRXENG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(O1)C(=NC=C2)Cl)O |
Computed by PubChem (NCBI)