CAS 1912-16-9 is the registry number for 2-Methyl-4,6-diphenylpyridine, 95+%. Offered by: AmBeed. Available pack sizes: 5mg.
2-methyl-4,6-diphenylpyridine (CAS 1912-16-9) is a chemical compound with the molecular formula C18H15N and a molecular weight of 245.3 g/mol. IUPAC name: 2-methyl-4,6-diphenylpyridine. InChIKey: KPUJGVVPKGQHPF-UHFFFAOYSA-N.
| Molecular formula | C18H15N |
|---|---|
| Molecular weight | 245.3 g/mol |
| IUPAC name | 2-methyl-4,6-diphenylpyridine |
| InChIKey | KPUJGVVPKGQHPF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=N1)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)