Products 1934434-93-1
CAS 1934434-93-1 appears in our catalog under these names: 5-Bromo-2-chlorobenzene-1-sulfonyl fluoride, 5-Bromo-2-chlorobenzene-1-sulfonyl fluoride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 2,5g, 250mg, 5g.
5-bromo-2-chlorobenzenesulfonyl fluoride (CAS 1934434-93-1) is a chemical compound with the molecular formula C6H3BrClFO2S and a molecular weight of 273.51 g/mol. IUPAC name: 5-bromo-2-chlorobenzenesulfonyl fluoride. InChIKey: IKGCZGNHGHPKND-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClFO2S |
|---|---|
| Molecular weight | 273.51 g/mol |
| IUPAC name | 5-bromo-2-chlorobenzenesulfonyl fluoride |
| InChIKey | IKGCZGNHGHPKND-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)S(=O)(=O)F)Cl |
Computed by PubChem (NCBI)