CAS 1934402-21-7 is the registry number for 2-Bromo-5-chlorobenzene-1-sulfonyl fluoride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-bromo-5-chlorobenzenesulfonyl fluoride (CAS 1934402-21-7) is a chemical compound with the molecular formula C6H3BrClFO2S and a molecular weight of 273.51 g/mol. IUPAC name: 2-bromo-5-chlorobenzenesulfonyl fluoride. InChIKey: VCFJUYKCXIJDSO-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClFO2S |
|---|---|
| Molecular weight | 273.51 g/mol |
| IUPAC name | 2-bromo-5-chlorobenzenesulfonyl fluoride |
| InChIKey | VCFJUYKCXIJDSO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)S(=O)(=O)F)Br |
Computed by PubChem (NCBI)