CAS 216159-03-4 appears in our catalog under these names: 4–Bromo–2–fluorobenzenesulfonyl Chloride, 4-Bromo-2-fluorobenzenesulfonyl chloride, 98% , 4-Bromo-2-fluorobenzenesulfonyl chloride, 97%, 4-Bromo-2-fluorobenzenesulfonyl Chloride, >98.0%(GC)(T). Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Fluorochem, TCI. Available pack sizes: 100g, 25g, 5g, 10g.
4-bromo-2-fluorobenzenesulfonyl chloride (CAS 216159-03-4) is a chemical compound with the molecular formula C6H3BrClFO2S and a molecular weight of 273.51 g/mol. IUPAC name: 4-bromo-2-fluorobenzenesulfonyl chloride. InChIKey: XNYBZLRIUHNRQY-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClFO2S |
|---|---|
| Molecular weight | 273.51 g/mol |
| IUPAC name | 4-bromo-2-fluorobenzenesulfonyl chloride |
| InChIKey | XNYBZLRIUHNRQY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)