Products 193633-47-5

CAS 193633-47-5 is the registry number for 3-Amino-3-(naphthalen-2-yl)propanoic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-amino-3-naphthalen-2-ylpropanoic acid;hydrochloride (CAS 193633-47-5) is a chemical compound with the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. IUPAC name: 3-amino-3-naphthalen-2-ylpropanoic acid;hydrochloride. InChIKey: FBQWTBUFZZBNNV-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14ClNO2
Molecular weight251.71 g/mol
IUPAC name3-amino-3-naphthalen-2-ylpropanoic acid;hydrochloride
InChIKeyFBQWTBUFZZBNNV-UHFFFAOYSA-N
SMILESC1=CC=C2C=C(C=CC2=C1)C(CC(=O)O)N.Cl

Computed by PubChem (NCBI)