CAS 194543-40-3 is the registry number for 3-Methylbenzene-1-sulfonyl isocyanate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-methyl-N-(oxomethylidene)benzenesulfonamide (CAS 194543-40-3) is a chemical compound with the molecular formula C8H7NO3S and a molecular weight of 197.21 g/mol. IUPAC name: 3-methyl-N-(oxomethylidene)benzenesulfonamide. InChIKey: NRPHEJYDQNWSJF-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3S |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | 3-methyl-N-(oxomethylidene)benzenesulfonamide |
| InChIKey | NRPHEJYDQNWSJF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)S(=O)(=O)N=C=O |
Computed by PubChem (NCBI)