Products 195050-48-7
CAS 195050-48-7 appears in our catalog under these names: (S)-2-Amino-3-(3-hydroxyphenyl)propanoic acid hydrochloride, 95%, (S)-2-Amino-3-(3-hydroxyphenyl)propanoic acid hcl, 98%, 98%, (S)-2-Amino-3-(3-hydroxyphenyl)propanoic acid hydrochloride, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(2S)-2-amino-3-(3-hydroxyphenyl)propanoic acid;hydrochloride (CAS 195050-48-7) is a chemical compound with the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. IUPAC name: (2S)-2-amino-3-(3-hydroxyphenyl)propanoic acid;hydrochloride. InChIKey: ISUKJARAXHJOJA-QRPNPIFTSA-N.
| Molecular formula | C9H12ClNO3 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | (2S)-2-amino-3-(3-hydroxyphenyl)propanoic acid;hydrochloride |
| InChIKey | ISUKJARAXHJOJA-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC(=C1)O)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)