CAS 1955505-85-7 is the registry number for 1-(2-Methylphenyl)-1H,2H,4H-pyrazolo(3,4-d)pyrimidin-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2-methylphenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 1955505-85-7) is a chemical compound with the molecular formula C12H10N4O and a molecular weight of 226.23 g/mol. IUPAC name: 1-(2-methylphenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: HJCRMBPAGYFMQE-UHFFFAOYSA-N.
| Molecular formula | C12H10N4O |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 1-(2-methylphenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | HJCRMBPAGYFMQE-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1N2C3=C(C=N2)C(=O)NC=N3 |
Computed by PubChem (NCBI)