Products 1955554-94-5
CAS 1955554-94-5 is the registry number for 4-(Aminomethyl)-2-methoxybenzoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(aminomethyl)-2-methoxybenzoic acid;hydrochloride (CAS 1955554-94-5) is a chemical compound with the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. IUPAC name: 4-(aminomethyl)-2-methoxybenzoic acid;hydrochloride. InChIKey: KFFAMNIMCRTKBG-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO3 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | 4-(aminomethyl)-2-methoxybenzoic acid;hydrochloride |
| InChIKey | KFFAMNIMCRTKBG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)CN)C(=O)O.Cl |
Computed by PubChem (NCBI)