CAS 1956306-77-6 appears in our catalog under these names: 1-(2-Chloro-3-fluorophenyl)ethanamine hydrochloride, 95%, 1–(2–Chloro–3–fluorophenyl)ethanamine hydrochloride, 1-(2-Chloro-3-fluorophenyl)ethanamine hydrochloride, 98%, 98%, 1-(2-Chloro-3-fluorophenyl)ethanamine hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 250mg, 50mg.
1-(2-chloro-3-fluorophenyl)ethanamine;hydrochloride (CAS 1956306-77-6) is a chemical compound with the molecular formula C8H10Cl2FN and a molecular weight of 210.07 g/mol. IUPAC name: 1-(2-chloro-3-fluorophenyl)ethanamine;hydrochloride. InChIKey: MBVZLDVQKRAIRO-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2FN |
|---|---|
| Molecular weight | 210.07 g/mol |
| IUPAC name | 1-(2-chloro-3-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | MBVZLDVQKRAIRO-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C(=CC=C1)F)Cl)N.Cl |
Computed by PubChem (NCBI)