Products 2804872-20-4
CAS 2804872-20-4 appears in our catalog under these names: (S)-1-(2-Chloro-3-fluorophenyl)ethan-1-amine (hydrochloride), 95%, 95%, (S)-1-(2-Chloro-3-fluorophenyl)ethan-1-amine (hydrochloride), 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
(1S)-1-(2-chloro-3-fluorophenyl)ethanamine;hydrochloride (CAS 2804872-20-4) is a chemical compound with the molecular formula C8H10Cl2FN and a molecular weight of 210.07 g/mol. IUPAC name: (1S)-1-(2-chloro-3-fluorophenyl)ethanamine;hydrochloride. InChIKey: MBVZLDVQKRAIRO-JEDNCBNOSA-N.
| Molecular formula | C8H10Cl2FN |
|---|---|
| Molecular weight | 210.07 g/mol |
| IUPAC name | (1S)-1-(2-chloro-3-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | MBVZLDVQKRAIRO-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=C(C(=CC=C1)F)Cl)N.Cl |
Computed by PubChem (NCBI)