CAS 19579-83-0 appears in our catalog under these names: Oxcarbazepine EP Impurity D, Dibenzazepine-10,11-dione, >95% (HPLC), Dibenzazepine-10,11-dione, 5H-Dibenz[b,f]azepine-10,11-dione 97%, 5H-Dibenz[b,f]azepine-10,11-dione, 97%, 97%. Offered by: Chemat Brand, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 100mg, 10mg, 25mg, 50mg, 250mg, 1g.
11H-benzo[b][1]benzazepine-5,6-dione (CAS 19579-83-0) is a chemical compound with the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. IUPAC name: 11H-benzo[b][1]benzazepine-5,6-dione. InChIKey: JDPDFSIEJKKSEC-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 11H-benzo[b][1]benzazepine-5,6-dione |
| InChIKey | JDPDFSIEJKKSEC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=O)C3=CC=CC=C3N2 |
Computed by PubChem (NCBI)