Products 196194-98-6
CAS 196194-98-6 appears in our catalog under these names: 2-Acetamido-5-methoxy-4-nitrobenzoic acid, 95%, 2-Acetamido-5-methoxy-4-nitrobenzoic acid, 97%, 2–Acetamido–5–methoxy–4–nitrobenzoic Acid, 2-Acetamido-5-methoxy-4-nitrobenzoic acid, >97%, >97%, 2-Acetamido-5-methoxy-4-nitrobenzoic acid, >97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
2-acetamido-5-methoxy-4-nitrobenzoic acid (CAS 196194-98-6) is a chemical compound with the molecular formula C10H10N2O6 and a molecular weight of 254.20 g/mol. IUPAC name: 2-acetamido-5-methoxy-4-nitrobenzoic acid. InChIKey: QWIICWOSUUZYES-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O6 |
|---|---|
| Molecular weight | 254.20 g/mol |
| IUPAC name | 2-acetamido-5-methoxy-4-nitrobenzoic acid |
| InChIKey | QWIICWOSUUZYES-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1C(=O)O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)