Products 249277-58-5

CAS 249277-58-5 is the registry number for 4-((2-Hydroxy-5-nitrophenyl)amino)-4-oxobutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(2-hydroxy-5-nitroanilino)-4-oxobutanoic acid (CAS 249277-58-5) is a chemical compound with the molecular formula C10H10N2O6 and a molecular weight of 254.20 g/mol. IUPAC name: 4-(2-hydroxy-5-nitroanilino)-4-oxobutanoic acid. InChIKey: OEARXQDXBRFQKR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10N2O6
Molecular weight254.20 g/mol
IUPAC name4-(2-hydroxy-5-nitroanilino)-4-oxobutanoic acid
InChIKeyOEARXQDXBRFQKR-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1[N+](=O)[O-])NC(=O)CCC(=O)O)O

Computed by PubChem (NCBI)