CAS 1621671-28-0 is the registry number for 1,3-Dimethyl 2-(3-nitropyridin-4-yl)propanedioate, 97%. Offered by: Combi-blocks. Available pack sizes: 1g.
Dimethyl 2-(3-nitro-4-pyridinyl)propanedioate (CAS 1621671-28-0) is a chemical compound with the molecular formula C10H10N2O6 and a molecular weight of 254.20 g/mol. IUPAC name: dimethyl 2-(3-nitro-4-pyridinyl)propanedioate. InChIKey: ABEKXTHLCPDVMX-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O6 |
|---|---|
| Molecular weight | 254.20 g/mol |
| IUPAC name | dimethyl 2-(3-nitro-4-pyridinyl)propanedioate |
| InChIKey | ABEKXTHLCPDVMX-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=C(C=NC=C1)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)