Products 30007-79-5
CAS 30007-79-5 appears in our catalog under these names: (((2-Nitrobenzyl)oxy)carbonyl)glycine, 98%, (((2–Nitrobenzyl)oxy)carbonyl)glycine. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
2-[(2-nitrophenyl)methoxycarbonylamino]acetic acid (CAS 30007-79-5) is a chemical compound with the molecular formula C10H10N2O6 and a molecular weight of 254.20 g/mol. IUPAC name: 2-[(2-nitrophenyl)methoxycarbonylamino]acetic acid. InChIKey: UJSSZZOALJWWTD-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O6 |
|---|---|
| Molecular weight | 254.20 g/mol |
| IUPAC name | 2-[(2-nitrophenyl)methoxycarbonylamino]acetic acid |
| InChIKey | UJSSZZOALJWWTD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC(=O)NCC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)