CAS 52412-59-6 appears in our catalog under these names: Dimethyl 4-amino-3-nitrobenzene-1,2-dioate, 95%, Dimethyl 4-amino-3-nitrobenzene-1,2-dioate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
Dimethyl 4-amino-3-nitrobenzene-1,2-dicarboxylate (CAS 52412-59-6) is a chemical compound with the molecular formula C10H10N2O6 and a molecular weight of 254.20 g/mol. IUPAC name: dimethyl 4-amino-3-nitrobenzene-1,2-dicarboxylate. InChIKey: VMCZLGPQSKPJTH-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O6 |
|---|---|
| Molecular weight | 254.20 g/mol |
| IUPAC name | dimethyl 4-amino-3-nitrobenzene-1,2-dicarboxylate |
| InChIKey | VMCZLGPQSKPJTH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)N)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)