CAS 1418117-86-8 appears in our catalog under these names: 2–(2,4–Dinitrophenyl)butanoic Acid, 2-(2,4-Dinitrophenyl)butanoic Acid, >95%, >95%, 2-(2,4-DINITROPHENYL)BUTANOIC ACID, >95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
2-(2,4-dinitrophenyl)butanoic acid (CAS 1418117-86-8) is a chemical compound with the molecular formula C10H10N2O6 and a molecular weight of 254.20 g/mol. IUPAC name: 2-(2,4-dinitrophenyl)butanoic acid. InChIKey: HCGPXJPXFRMKMP-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O6 |
|---|---|
| Molecular weight | 254.20 g/mol |
| IUPAC name | 2-(2,4-dinitrophenyl)butanoic acid |
| InChIKey | HCGPXJPXFRMKMP-UHFFFAOYSA-N |
| SMILES | CCC(C1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)