CAS 24273-19-6 appears in our catalog under these names: 2,4-Dinitrophenyl Butyrate, Butanoic acid, 2,4-dinitrophenyl ester. Offered by: TRC, Biosynth, Chemat. Available pack sizes: 500mg, 0,5g, 1g, 2g, 5g, 10g, 100mg, 250mg.
(2,4-dinitrophenyl) butanoate (CAS 24273-19-6) is a chemical compound with the molecular formula C10H10N2O6 and a molecular weight of 254.20 g/mol. IUPAC name: (2,4-dinitrophenyl) butanoate. InChIKey: SBVYGYGWGWKSIL-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O6 |
|---|---|
| Molecular weight | 254.20 g/mol |
| IUPAC name | (2,4-dinitrophenyl) butanoate |
| InChIKey | SBVYGYGWGWKSIL-UHFFFAOYSA-N |
| SMILES | CCCC(=O)OC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)