CAS 103039-34-5 is the registry number for Ethyl 5-methyl-2,4-dinitrobenzoate, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 25g, 10g, 5g, 1g.
Ethyl 5-methyl-2,4-dinitrobenzoate (CAS 103039-34-5) is a chemical compound with the molecular formula C10H10N2O6 and a molecular weight of 254.20 g/mol. IUPAC name: ethyl 5-methyl-2,4-dinitrobenzoate. InChIKey: IUNWYBCKKXSNTK-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O6 |
|---|---|
| Molecular weight | 254.20 g/mol |
| IUPAC name | ethyl 5-methyl-2,4-dinitrobenzoate |
| InChIKey | IUNWYBCKKXSNTK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C(=C1)C)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)