CAS 196205-08-0 is the registry number for 7-Chloro-5-nitroindoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-5-nitro-2,3-dihydro-1H-indole (CAS 196205-08-0) is a chemical compound with the molecular formula C8H7ClN2O2 and a molecular weight of 198.60 g/mol. IUPAC name: 7-chloro-5-nitro-2,3-dihydro-1H-indole. InChIKey: MDFIYXAUHLQZBB-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O2 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 7-chloro-5-nitro-2,3-dihydro-1H-indole |
| InChIKey | MDFIYXAUHLQZBB-UHFFFAOYSA-N |
| SMILES | C1CNC2=C1C=C(C=C2Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)