CAS 1980044-16-3 is the registry number for 3-(3-Bromophenyl)bicyclo(1.1.1)pentane-1-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
3-(3-bromophenyl)bicyclo[1.1.1]pentane-1-carboxylic acid (CAS 1980044-16-3) is a chemical compound with the molecular formula C12H11BrO2 and a molecular weight of 267.12 g/mol. IUPAC name: 3-(3-bromophenyl)bicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: FDAYGYNIBRICGI-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO2 |
|---|---|
| Molecular weight | 267.12 g/mol |
| IUPAC name | 3-(3-bromophenyl)bicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | FDAYGYNIBRICGI-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)C(=O)O)C3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)