CAS 1982-42-9 is the registry number for 2-(2,4-Dichlorophenoxy)acetamide. Offered by: TRC. Available pack sizes: 25mg.
2-(2,4-dichlorophenoxy)acetamide (CAS 1982-42-9) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: 2-(2,4-dichlorophenoxy)acetamide. InChIKey: VGVRFARTWVJNQC-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | 2-(2,4-dichlorophenoxy)acetamide |
| InChIKey | VGVRFARTWVJNQC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)OCC(=O)N |
Computed by PubChem (NCBI)