CAS 1993403-84-1 is the registry number for 3,4-Dicyclopropoxybenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,4-dicyclopropyloxybenzoic acid (CAS 1993403-84-1) is a chemical compound with the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. IUPAC name: 3,4-dicyclopropyloxybenzoic acid. InChIKey: SIZDLUUXEYAGFV-UHFFFAOYSA-N.
| Molecular formula | C13H14O4 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 3,4-dicyclopropyloxybenzoic acid |
| InChIKey | SIZDLUUXEYAGFV-UHFFFAOYSA-N |
| SMILES | C1CC1OC2=C(C=C(C=C2)C(=O)O)OC3CC3 |
Computed by PubChem (NCBI)