CAS 199679-41-9 is the registry number for (2E)-3-(4-(Methylsulfamoyl)phenyl)prop-2-enoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
(E)-3-[4-(methylsulfamoyl)phenyl]prop-2-enoic acid (CAS 199679-41-9) is a chemical compound with the molecular formula C10H11NO4S and a molecular weight of 241.27 g/mol. IUPAC name: (E)-3-[4-(methylsulfamoyl)phenyl]prop-2-enoic acid. InChIKey: WEYOEFGCURUXDM-QPJJXVBHSA-N.
| Molecular formula | C10H11NO4S |
|---|---|
| Molecular weight | 241.27 g/mol |
| IUPAC name | (E)-3-[4-(methylsulfamoyl)phenyl]prop-2-enoic acid |
| InChIKey | WEYOEFGCURUXDM-QPJJXVBHSA-N |
| SMILES | CNS(=O)(=O)C1=CC=C(C=C1)/C=C/C(=O)O |
Computed by PubChem (NCBI)