Products 201150-65-4
CAS 201150-65-4 appears in our catalog under these names: 4，5–Dichloro–2–methoxybenzoic acid, 4,5-Dichloro-2-methoxybenzoic acid, 4,5-Dichloro-2-methoxybenzoic acid 97%, 4,5-Dichloro-2-methoxybenzoic acid, 97%, 97%, 4,5-Dichloro-2-methoxybenzoic acid, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 2,5g, 5g.
4,5-dichloro-2-methoxybenzoic acid (CAS 201150-65-4) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 221.03 g/mol. IUPAC name: 4,5-dichloro-2-methoxybenzoic acid. InChIKey: WBFXTOLYBVHEHR-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 221.03 g/mol |
| IUPAC name | 4,5-dichloro-2-methoxybenzoic acid |
| InChIKey | WBFXTOLYBVHEHR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)