CAS 201164-18-3 appears in our catalog under these names: rac-(1R,2R)-2-(4-(Trifluoromethyl)phenyl)cyclopropane-1-carboxylic acid, (1R,2R)-2-(4-(trifluoromethyl)phenyl)cyclopropane-1-carboxylic acid, 97%, 97%, rel- (1R,2R)-2-(4-(Trifluoromethyl)phenyl)cyclopropanecarboxylic acid, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g, 5g, 100g, 10g.
Trans-(1R,2R)-2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid (CAS 201164-18-3) is a chemical compound with the molecular formula C11H9F3O2 and a molecular weight of 230.18 g/mol. IUPAC name: trans-(1R,2R)-2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid. InChIKey: UKRIUIRBTVRYAH-DTWKUNHWSA-N.
| Molecular formula | C11H9F3O2 |
|---|---|
| Molecular weight | 230.18 g/mol |
| IUPAC name | trans-(1R,2R)-2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid |
| InChIKey | UKRIUIRBTVRYAH-DTWKUNHWSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)