CAS 201479-09-6 appears in our catalog under these names: H-M-Fluoro-D-Phe-OMe hydrochloride, 97%, H–m–Fluoro–D–Phe–OMe · HCl, (R)-Methyl 2-amino-3-(3-fluorophenyl)propanoate hydrochloride, 98%, 98%, METHYL 3-(3-FLUOROPHENYL)-D-ALANINE HCL, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
Methyl (2R)-2-amino-3-(3-fluorophenyl)propanoate;hydrochloride (CAS 201479-09-6) is a chemical compound with the molecular formula C10H13ClFNO2 and a molecular weight of 233.67 g/mol. IUPAC name: methyl (2R)-2-amino-3-(3-fluorophenyl)propanoate;hydrochloride. InChIKey: LIYCRVHARXGJKA-SBSPUUFOSA-N.
| Molecular formula | C10H13ClFNO2 |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(3-fluorophenyl)propanoate;hydrochloride |
| InChIKey | LIYCRVHARXGJKA-SBSPUUFOSA-N |
| SMILES | COC(=O)[C@@H](CC1=CC(=CC=C1)F)N.Cl |
Computed by PubChem (NCBI)