CAS 64493-16-9 appears in our catalog under these names: Methyl 2–amino–3–(3–fluorophenyl)propanoate hydrochloride, Methyl 2-amino-3-(3-fluorophenyl)propanoate hydrochloride, Methyl 2-amino-3-(3-fluorophenyl)propanoate hydrochloride, 98%, 98%, Methyl 2-amino-3-(3-fluorophenyl)propanoate hydrochloride, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 2,5g, 250mg, 1g, 5g, 2.5g.
Methyl 2-amino-3-(3-fluorophenyl)propanoate;hydrochloride (CAS 64493-16-9) is a chemical compound with the molecular formula C10H13ClFNO2 and a molecular weight of 233.67 g/mol. IUPAC name: methyl 2-amino-3-(3-fluorophenyl)propanoate;hydrochloride. InChIKey: LIYCRVHARXGJKA-UHFFFAOYSA-N.
| Molecular formula | C10H13ClFNO2 |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | methyl 2-amino-3-(3-fluorophenyl)propanoate;hydrochloride |
| InChIKey | LIYCRVHARXGJKA-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=CC(=CC=C1)F)N.Cl |
Computed by PubChem (NCBI)