CAS 201933-03-1 appears in our catalog under these names: Methyl 3-(acetoxymethyl)-4-nitrobenzoate, 97%, Methyl 3–(acetoxymethyl)–4–nitrobenzoate. Offered by: AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g.
Methyl 3-(acetyloxymethyl)-4-nitrobenzoate (CAS 201933-03-1) is a chemical compound with the molecular formula C11H11NO6 and a molecular weight of 253.21 g/mol. IUPAC name: methyl 3-(acetyloxymethyl)-4-nitrobenzoate. InChIKey: DTOYHEZLUYOUOE-UHFFFAOYSA-N.
| Molecular formula | C11H11NO6 |
|---|---|
| Molecular weight | 253.21 g/mol |
| IUPAC name | methyl 3-(acetyloxymethyl)-4-nitrobenzoate |
| InChIKey | DTOYHEZLUYOUOE-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1=C(C=CC(=C1)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)