CAS 2021244-96-0 appears in our catalog under these names: 2-((4-Bromo-1H-pyrazol-1-yl)methyl)pyrazine, 95%, 95%, 2-((4-Bromo-1H-pyrazol-1-yl)methyl)pyrazine, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-[(4-bromopyrazol-1-yl)methyl]pyrazine (CAS 2021244-96-0) is a chemical compound with the molecular formula C8H7BrN4 and a molecular weight of 239.07 g/mol. IUPAC name: 2-[(4-bromopyrazol-1-yl)methyl]pyrazine. InChIKey: TWGMHEQBGGCTJG-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN4 |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 2-[(4-bromopyrazol-1-yl)methyl]pyrazine |
| InChIKey | TWGMHEQBGGCTJG-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)CN2C=C(C=N2)Br |
Computed by PubChem (NCBI)