Products 202190-50-9
CAS 202190-50-9 appears in our catalog under these names: L–Lysine–13C dihydrochloride, L-Lysine-13C (dihydrochloride), 99.90%, L-Lysine-13C (dihydrochloride), 99%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 10mg, 5mg, 5 mg, 1 mg, 10 mg.
(2S)-2,6-diamino(113C)hexanoic acid;dihydrochloride (CAS 202190-50-9) is a chemical compound with the molecular formula C6H16Cl2N2O2 and a molecular weight of 220.10 g/mol. IUPAC name: (2S)-2,6-diamino(113C)hexanoic acid;dihydrochloride. InChIKey: JBBURJFZIMRPCZ-HSCIIBSRSA-N.
| Molecular formula | C6H16Cl2N2O2 |
|---|---|
| Molecular weight | 220.10 g/mol |
| IUPAC name | (2S)-2,6-diamino(113C)hexanoic acid;dihydrochloride |
| InChIKey | JBBURJFZIMRPCZ-HSCIIBSRSA-N |
| SMILES | C(CCN)C[C@@H]([13C](=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)