Products 202406-54-0
CAS 202406-54-0 appears in our catalog under these names: L–Lysine–13C6,15N2 dihydrochloride, L-Lysine-13C6,15N2 (dihydrochloride), 99.58%, L-Lysine-13C6,15N2 (dihydrochloride), L-Lysine-13C6,15N2 (dihydrochloride), 98%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 10 mg, 50 mg, 25 mg, 100 mg, 5 mg, 100g, 500g.
(2S)-2,6-bis(15N)(azanyl)(1,2,3,4,5,6-13C6)hexanoic acid;dihydrochloride (CAS 202406-54-0) is a chemical compound with the molecular formula C6H16Cl2N2O2 and a molecular weight of 227.05 g/mol. IUPAC name: (2S)-2,6-bis(15N)(azanyl)(1,2,3,4,5,6-13C6)hexanoic acid;dihydrochloride. InChIKey: JBBURJFZIMRPCZ-XLWLNXBUSA-N.
| Molecular formula | C6H16Cl2N2O2 |
|---|---|
| Molecular weight | 227.05 g/mol |
| IUPAC name | (2S)-2,6-bis(15N)(azanyl)(1,2,3,4,5,6-13C6)hexanoic acid;dihydrochloride |
| InChIKey | JBBURJFZIMRPCZ-XLWLNXBUSA-N |
| SMILES | [13CH2]([13CH2][13CH2][15NH2])[13CH2][13C@@H]([13C](=O)O)[15NH2].Cl.Cl |
Computed by PubChem (NCBI)