Products 20294-52-4
CAS 20294-52-4 appears in our catalog under these names: 4-Methyl-2,5-dinitrophenol, 95%, 4-methyl-2,5-dinitrophenol, >95% (HPLC), 4-methyl-2,5-dinitrophenol, 97%, 97%. Offered by: Fluorochem, TRC, Chemat. Available pack sizes: 100mg, 250mg, 1g, 10mg, 1mg, 2mg.
4-methyl-2,5-dinitrophenol (CAS 20294-52-4) is a chemical compound with the molecular formula C7H6N2O5 and a molecular weight of 198.13 g/mol. IUPAC name: 4-methyl-2,5-dinitrophenol. InChIKey: KBKKXHQMXZFCLI-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O5 |
|---|---|
| Molecular weight | 198.13 g/mol |
| IUPAC name | 4-methyl-2,5-dinitrophenol |
| InChIKey | KBKKXHQMXZFCLI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1[N+](=O)[O-])O)[N+](=O)[O-] |
Computed by PubChem (NCBI)